C22H19N7O2 — CID 142057186
6-(naphthalen-1-ylmethylamino)-9-[5-(nitrosomethyl)oxolan-2-yl]purine-2-carbonitrile (PubChem CID 142057186) has the molecular formula C22H19N7O2 and a molecular weight of 413.44 g/mol. Its IUPAC name is 6-(naphthalen-1-ylmethylamino)-9-[5-(nitrosomethyl)oxolan-2-yl]purine-2-carbonitrile.
| Compound Name | 6-(naphthalen-1-ylmethylamino)-9-[5-(nitrosomethyl)oxolan-2-yl]purine-2-carbonitrile |
|---|---|
| PubChem CID | 142057186 |
| Molecular Formula | C22H19N7O2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 6-(naphthalen-1-ylmethylamino)-9-[5-(nitrosomethyl)oxolan-2-yl]purine-2-carbonitrile |
| SMILES | N#Cc1nc(NCc2cccc3ccccc23)c2ncn(C3CCC(CN=O)O3)c2n1 |
| InChI | InChI=1S/C22H19N7O2/c23-10-18-27-21(24-11-15-6-3-5-14-4-1-2-7-17(14)15)20-22(28-18)29(13-25-20)19-9-8-16(31-19)12-26-30/h1-7,13,16,19H,8-9,11-12H2,(H,24,27,28) |
| InChIKey | SDIXKCCYESIPAJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |