C24H28N6O5 — CID 46875677
(2R,3S,4R)-2-(hydroxymethyl)-5-[2-(3-hydroxypropylamino)-6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 46875677) has the molecular formula C24H28N6O5 and a molecular weight of 480.53 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-[2-(3-hydroxypropylamino)-6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[2-(3-hydroxypropylamino)-6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 46875677 |
| Molecular Formula | C24H28N6O5 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[2-(3-hydroxypropylamino)-6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | OCCCNc1nc(NCc2cccc3ccccc23)c2ncn(C3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C24H28N6O5/c31-10-4-9-25-24-28-21(26-11-15-7-3-6-14-5-1-2-8-16(14)15)18-22(29-24)30(13-27-18)23-20(34)19(33)17(12-32)35-23/h1-3,5-8,13,17,19-20,23,31-34H,4,9-12H2,(H2,25,26,28,29)/t17-,19-,20-,23?/m1/s1 |
| InChIKey | RCZYKWCAJBCZMI-PSBUXNCMSA-N |
| XLogP | 1.00 |
| TPSA | 157.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|