C27H23N5O4 — CID 89211978
(2R,3R,5R)-2-(hydroxymethyl)-5-[6-(pyren-1-ylmethylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 89211978) has the molecular formula C27H23N5O4 and a molecular weight of 481.51 g/mol. Its IUPAC name is (2R,3R,5R)-2-(hydroxymethyl)-5-[6-(pyren-1-ylmethylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,5R)-2-(hydroxymethyl)-5-[6-(pyren-1-ylmethylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 89211978 |
| Molecular Formula | C27H23N5O4 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (2R,3R,5R)-2-(hydroxymethyl)-5-[6-(pyren-1-ylmethylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCc4ccc5ccc6cccc7ccc4c5c67)ncnc32)C(O)[C@H]1O |
| InChI | InChI=1S/C27H23N5O4/c33-11-19-23(34)24(35)27(36-19)32-13-31-22-25(29-12-30-26(22)32)28-10-17-7-6-16-5-4-14-2-1-3-15-8-9-18(17)21(16)20(14)15/h1-9,12-13,19,23-24,27,33-35H,10-11H2,(H,28,29,30)/t19-,23+,24?,27-/m1/s1 |
| InChIKey | RLTHPBOMZZRVCC-NNIHLSNOSA-N |
| XLogP | 2.95 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|