C30H36N8O4 — CID 44585183
(2R,3R,4S,5R)-2-[2,6-bis[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 44585183) has the molecular formula C30H36N8O4 and a molecular weight of 572.67 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2,6-bis[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2,6-bis[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 44585183 |
| Molecular Formula | C30H36N8O4 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2,6-bis[2-(2,3-dihydro-1H-indol-3-yl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCCC4CNc5ccccc54)nc(NCCC4CNc5ccccc54)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H36N8O4/c39-15-23-25(40)26(41)29(42-23)38-16-35-24-27(31-11-9-17-13-33-21-7-3-1-5-19(17)21)36-30(37-28(24)38)32-12-10-18-14-34-22-8-4-2-6-20(18)22/h1-8,16-18,23,25-26,29,33-34,39-41H,9-15H2,(H2,31,32,36,37)/t17?,18?,23-,25-,26-,29-/m1/s1 |
| InChIKey | PHLQRENNIZRAJQ-MYBFIRPESA-N |
| XLogP | 2.46 |
| TPSA | 161.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |