C22H20N6O2 — CID 142057184
9-[5-(hydroxymethyl)oxolan-2-yl]-6-(naphthalen-1-ylmethylamino)purine-2-carbonitrile (PubChem CID 142057184) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 9-[5-(hydroxymethyl)oxolan-2-yl]-6-(naphthalen-1-ylmethylamino)purine-2-carbonitrile.
| Compound Name | 9-[5-(hydroxymethyl)oxolan-2-yl]-6-(naphthalen-1-ylmethylamino)purine-2-carbonitrile |
|---|---|
| PubChem CID | 142057184 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 9-[5-(hydroxymethyl)oxolan-2-yl]-6-(naphthalen-1-ylmethylamino)purine-2-carbonitrile |
| SMILES | N#Cc1nc(NCc2cccc3ccccc23)c2ncn(C3CCC(CO)O3)c2n1 |
| InChI | InChI=1S/C22H20N6O2/c23-10-18-26-21(24-11-15-6-3-5-14-4-1-2-7-17(14)15)20-22(27-18)28(13-25-20)19-9-8-16(12-29)30-19/h1-7,13,16,19,29H,8-9,11-12H2,(H,24,26,27) |
| InChIKey | NBYMIIFTFIVEMR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |