C26H32N8O — CID 90332835
4-[[9-cyclopentyl-6-[(4-pyrazol-1-ylphenyl)methylamino]purin-2-yl]amino]cyclohexan-1-ol (PubChem CID 90332835) has the molecular formula C26H32N8O and a molecular weight of 472.60 g/mol. Its IUPAC name is 4-[[9-cyclopentyl-6-[(4-pyrazol-1-ylphenyl)methylamino]purin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[9-cyclopentyl-6-[(4-pyrazol-1-ylphenyl)methylamino]purin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 90332835 |
| Molecular Formula | C26H32N8O |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 4-[[9-cyclopentyl-6-[(4-pyrazol-1-ylphenyl)methylamino]purin-2-yl]amino]cyclohexan-1-ol |
| SMILES | OC1CCC(Nc2nc(NCc3ccc(-n4cccn4)cc3)c3ncn(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C26H32N8O/c35-22-12-8-19(9-13-22)30-26-31-24(23-25(32-26)33(17-28-23)20-4-1-2-5-20)27-16-18-6-10-21(11-7-18)34-15-3-14-29-34/h3,6-7,10-11,14-15,17,19-20,22,35H,1-2,4-5,8-9,12-13,16H2,(H2,27,30,31,32) |
| InChIKey | ITDZYORNTGYQSR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |