C15H16ClF3N6O4 — CID 87082889
[(1S,2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate (PubChem CID 87082889) has the molecular formula C15H16ClF3N6O4 and a molecular weight of 436.78 g/mol. Its IUPAC name is [(1S,2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87082889 |
| Molecular Formula | C15H16ClF3N6O4 |
| Molecular Weight | 436.78 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | [(1S,2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@H](OC(=O)C(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C15H16ClF3N6O4/c1-2-7(26)22-5-3-6(10(9(5)27)29-13(28)15(17,18)19)25-4-21-8-11(20)23-14(16)24-12(8)25/h4-6,9-10,27H,2-3H2,1H3,(H,22,26)(H2,20,23,24)/t5-,6+,9+,10-/m0/s1 |
| InChIKey | CDJACMFWKPECPE-ZRVLKLQWSA-N |
| XLogP | 0.74 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.78 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |