C23H26F3N7O4 — CID 67019371
[(1S,2R,3S,5R)-5-[6-amino-2-(2-phenylethylamino)purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate (PubChem CID 67019371) has the molecular formula C23H26F3N7O4 and a molecular weight of 521.50 g/mol. Its IUPAC name is [(1S,2R,3S,5R)-5-[6-amino-2-(2-phenylethylamino)purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,2R,3S,5R)-5-[6-amino-2-(2-phenylethylamino)purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67019371 |
| Molecular Formula | C23H26F3N7O4 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | [(1S,2R,3S,5R)-5-[6-amino-2-(2-phenylethylamino)purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(N)nc(NCCc4ccccc4)nc32)[C@H](OC(=O)C(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C23H26F3N7O4/c1-2-15(34)30-13-10-14(18(17(13)35)37-21(36)23(24,25)26)33-11-29-16-19(27)31-22(32-20(16)33)28-9-8-12-6-4-3-5-7-12/h3-7,11,13-14,17-18,35H,2,8-10H2,1H3,(H,30,34)(H3,27,28,31,32)/t13-,14+,17+,18-/m0/s1 |
| InChIKey | SOFGQLJGWUIVIJ-JFTQMJAMSA-N |
| XLogP | 1.74 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |