C23H28F3N7O3 — CID 87238458
N-[(1S,2R,3S,4R)-4-[6-amino-2-(2-phenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide (PubChem CID 87238458) has the molecular formula C23H28F3N7O3 and a molecular weight of 507.52 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[6-amino-2-(2-phenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[6-amino-2-(2-phenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide |
|---|---|
| PubChem CID | 87238458 |
| Molecular Formula | C23H28F3N7O3 |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[6-amino-2-(2-phenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide |
| SMILES | CCCN(C(=O)C(F)(F)F)[C@H]1C[C@@H](n2cnc3c(N)nc(NCCc4ccccc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H28F3N7O3/c1-2-10-32(21(36)23(24,25)26)14-11-15(18(35)17(14)34)33-12-29-16-19(27)30-22(31-20(16)33)28-9-8-13-6-4-3-5-7-13/h3-7,12,14-15,17-18,34-35H,2,8-11H2,1H3,(H3,27,28,30,31)/t14-,15+,17+,18-/m0/s1 |
| InChIKey | IPBDNWBKJDRQKY-IDCNUPLLSA-N |
| XLogP | 1.90 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |