C21H27F3N6O3 — CID 88867845
N-[4-(6-amino-2-hex-1-ynylpurin-9-yl)-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide (PubChem CID 88867845) has the molecular formula C21H27F3N6O3 and a molecular weight of 468.48 g/mol. Its IUPAC name is N-[4-(6-amino-2-hex-1-ynylpurin-9-yl)-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide.
| Compound Name | N-[4-(6-amino-2-hex-1-ynylpurin-9-yl)-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide |
|---|---|
| PubChem CID | 88867845 |
| Molecular Formula | C21H27F3N6O3 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N-[4-(6-amino-2-hex-1-ynylpurin-9-yl)-2,3-dihydroxycyclopentyl]-2,2,2-trifluoro-N-propylacetamide |
| SMILES | CCCCC#Cc1nc(N)c2ncn(C3CC(N(CCC)C(=O)C(F)(F)F)C(O)C3O)c2n1 |
| InChI | InChI=1S/C21H27F3N6O3/c1-3-5-6-7-8-14-27-18(25)15-19(28-14)30(11-26-15)13-10-12(16(31)17(13)32)29(9-4-2)20(33)21(22,23)24/h11-13,16-17,31-32H,3-6,9-10H2,1-2H3,(H2,25,27,28) |
| InChIKey | XEWPALMNTHJWMK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|