C31H41F3N10O4 — CID 66631280
[(1S,3S,5R)-5-[2-[3-(dimethylamino)pyrrolidin-1-yl]-6-[(1-pyridin-2-ylpiperidin-4-yl)amino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate (PubChem CID 66631280) has the molecular formula C31H41F3N10O4 and a molecular weight of 674.73 g/mol. Its IUPAC name is [(1S,3S,5R)-5-[2-[3-(dimethylamino)pyrrolidin-1-yl]-6-[(1-pyridin-2-ylpiperidin-4-yl)amino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,3S,5R)-5-[2-[3-(dimethylamino)pyrrolidin-1-yl]-6-[(1-pyridin-2-ylpiperidin-4-yl)amino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 66631280 |
| Molecular Formula | C31H41F3N10O4 |
| Molecular Weight | 674.73 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | [(1S,3S,5R)-5-[2-[3-(dimethylamino)pyrrolidin-1-yl]-6-[(1-pyridin-2-ylpiperidin-4-yl)amino]purin-9-yl]-2-hydroxy-3-(propanoylamino)cyclopentyl] 2,2,2-trifluoroacetate |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(NC4CCN(c5ccccn5)CC4)nc(N4CCC(N(C)C)C4)nc32)[C@H](OC(=O)C(F)(F)F)C1O |
| InChI | InChI=1S/C31H41F3N10O4/c1-4-23(45)38-20-15-21(26(25(20)46)48-29(47)31(32,33)34)44-17-36-24-27(37-18-8-12-42(13-9-18)22-7-5-6-11-35-22)39-30(40-28(24)44)43-14-10-19(16-43)41(2)3/h5-7,11,17-21,25-26,46H,4,8-10,12-16H2,1-3H3,(H,38,45)(H,37,39,40)/t19?,20-,21+,25?,26-/m0/s1 |
| InChIKey | PHSNGEFKBVPJOG-VGFMHQDJSA-N |
| XLogP | 2.12 |
| TPSA | 153.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.73 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |