C29H46N8O3 — CID 66630581
N-[(1S,2R,3S,4R)-4-[6-[[(1S,2S)-2-cyclopentylcyclopentyl]amino]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 66630581) has the molecular formula C29H46N8O3 and a molecular weight of 554.74 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[6-[[(1S,2S)-2-cyclopentylcyclopentyl]amino]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[6-[[(1S,2S)-2-cyclopentylcyclopentyl]amino]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 66630581 |
| Molecular Formula | C29H46N8O3 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.37 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[6-[[(1S,2S)-2-cyclopentylcyclopentyl]amino]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(N[C@H]4CCC[C@H]4C4CCCC4)nc(N4CC[C@@H](N(C)C)C4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H46N8O3/c1-4-23(38)31-21-14-22(26(40)25(21)39)37-16-30-24-27(32-20-11-7-10-19(20)17-8-5-6-9-17)33-29(34-28(24)37)36-13-12-18(15-36)35(2)3/h16-22,25-26,39-40H,4-15H2,1-3H3,(H,31,38)(H,32,33,34)/t18-,19+,20+,21+,22-,25-,26+/m1/s1 |
| InChIKey | VFDYZJXGNPWXHD-YMRPUBFXSA-N |
| XLogP | 2.30 |
| TPSA | 131.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |