C27H33ClN8O3 — CID 66630567
9-[(1R,2S,3R,4S)-4-amino-2,3-dihydroxycyclopentyl]-N-(2-aminoethyl)-6-(2,2-diphenylethylamino)purine-2-carboxamide;hydrochloride (PubChem CID 66630567) has the molecular formula C27H33ClN8O3 and a molecular weight of 553.07 g/mol. Its IUPAC name is 9-[(1R,2S,3R,4S)-4-amino-2,3-dihydroxycyclopentyl]-N-(2-aminoethyl)-6-(2,2-diphenylethylamino)purine-2-carboxamide;hydrochloride.
| Compound Name | 9-[(1R,2S,3R,4S)-4-amino-2,3-dihydroxycyclopentyl]-N-(2-aminoethyl)-6-(2,2-diphenylethylamino)purine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 66630567 |
| Molecular Formula | C27H33ClN8O3 |
| Molecular Weight | 553.07 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 9-[(1R,2S,3R,4S)-4-amino-2,3-dihydroxycyclopentyl]-N-(2-aminoethyl)-6-(2,2-diphenylethylamino)purine-2-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)c1nc(NCC(c2ccccc2)c2ccccc2)c2ncn([C@@H]3C[C@H](N)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C27H32N8O3.ClH/c28-11-12-30-27(38)25-33-24(21-26(34-25)35(15-32-21)20-13-19(29)22(36)23(20)37)31-14-18(16-7-3-1-4-8-16)17-9-5-2-6-10-17;/h1-10,15,18-20,22-23,36-37H,11-14,28-29H2,(H,30,38)(H,31,33,34);1H/t19-,20+,22+,23-;/m0./s1 |
| InChIKey | RBVZWPSQXKWFHB-XWAYGANISA-N |
| XLogP | 1.17 |
| TPSA | 177.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.07 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |