C24H26N6O2 — CID 117085845
[1-[6-(2-phenoxyethylamino)-9-phenylpurin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 117085845) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is [1-[6-(2-phenoxyethylamino)-9-phenylpurin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[6-(2-phenoxyethylamino)-9-phenylpurin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 117085845 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | [1-[6-(2-phenoxyethylamino)-9-phenylpurin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1c1nc(NCCOc2ccccc2)c2ncn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C24H26N6O2/c31-16-19-10-7-14-29(19)24-27-22(25-13-15-32-20-11-5-2-6-12-20)21-23(28-24)30(17-26-21)18-8-3-1-4-9-18/h1-6,8-9,11-12,17,19,31H,7,10,13-16H2,(H,25,27,28) |
| InChIKey | CKSDWIBAZNHWHY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|