C28H27N7O2 — CID 117082236
2-(6-morpholin-4-yl-3-pyridinyl)-N-(2-phenoxyethyl)-9-phenylpurin-6-amine (PubChem CID 117082236) has the molecular formula C28H27N7O2 and a molecular weight of 493.57 g/mol. Its IUPAC name is 2-(6-morpholin-4-yl-3-pyridinyl)-N-(2-phenoxyethyl)-9-phenylpurin-6-amine.
| Compound Name | 2-(6-morpholin-4-yl-3-pyridinyl)-N-(2-phenoxyethyl)-9-phenylpurin-6-amine |
|---|---|
| PubChem CID | 117082236 |
| Molecular Formula | C28H27N7O2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 2-(6-morpholin-4-yl-3-pyridinyl)-N-(2-phenoxyethyl)-9-phenylpurin-6-amine |
| SMILES | c1ccc(OCCNc2nc(-c3ccc(N4CCOCC4)nc3)nc3c2ncn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27N7O2/c1-3-7-22(8-4-1)35-20-31-25-27(29-13-16-37-23-9-5-2-6-10-23)32-26(33-28(25)35)21-11-12-24(30-19-21)34-14-17-36-18-15-34/h1-12,19-20H,13-18H2,(H,29,32,33) |
| InChIKey | MPBRKECGKOXREW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|