About N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine
N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine (PubChem CID 58451194) has the molecular formula C14H15N7
and a molecular weight of 281.32 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine |
| PubChem CID | 58451194 |
| Molecular Formula | C14H15N7 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine |
| SMILES | NNc1nc(NC2Cc3ccccc3C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H15N7/c15-21-14-19-12-11(16-7-17-12)13(20-14)18-10-5-8-3-1-2-4-9(8)6-10/h1-4,7,10H,5-6,15H2,(H3,16,17,18,19,20,21) |
| InChIKey | JXEBEENFKMSQOX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine?
The IUPAC name of N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine (CID 58451194) is N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine.
What is the SMILES notation for N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine?
The canonical SMILES for N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine is NNc1nc(NC2Cc3ccccc3C2)c2[nH]cnc2n1.
What is the InChIKey of N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine?
The InChIKey is JXEBEENFKMSQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N7/c15-21-14-19-12-11(16-7-17-12)13(20-14)18-10-5-8-3-1-2-4-9(8)6-10/h1-4,7,10H,5-6,15H2,(H3,16,17,18,19,20,21).
What are the key properties of N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine?
N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine has a molecular weight of 281.32 g/mol, XLogP of 1.22, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-6-amine is sourced from PubChem (CID 58451194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).