C14H15N7 — CID 107855056
N-(2,3-dihydro-1H-inden-2-yl)-6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 107855056) has the molecular formula C14H15N7 and a molecular weight of 281.32 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 107855056 |
| Molecular Formula | C14H15N7 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | NNc1nc(NC2Cc3ccccc3C2)c2cn[nH]c2n1 |
| InChI | InChI=1S/C14H15N7/c15-20-14-18-12(11-7-16-21-13(11)19-14)17-10-5-8-3-1-2-4-9(8)6-10/h1-4,7,10H,5-6,15H2,(H3,16,17,18,19,20,21) |
| InChIKey | FGYVLYUJODOXME-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|