C14H16N7+ — CID 123305427
N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-9-ium-6-amine (PubChem CID 123305427) has the molecular formula C14H16N7+ and a molecular weight of 282.33 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-9-ium-6-amine.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-9-ium-6-amine |
|---|---|
| PubChem CID | 123305427 |
| Molecular Formula | C14H16N7+ |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-2-hydrazinyl-7H-purin-9-ium-6-amine |
| SMILES | NNc1nc(NC2Cc3ccccc3C2)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C14H15N7/c15-21-14-19-12-11(16-7-17-12)13(20-14)18-10-5-8-3-1-2-4-9(8)6-10/h1-4,7,10H,5-6,15H2,(H3,16,17,18,19,20,21)/p+1 |
| InChIKey | JXEBEENFKMSQOX-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|