C11H15N7O — CID 114785220
5-[[2-(methylamino)-7H-purin-6-yl]amino]piperidin-2-one (PubChem CID 114785220) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is 5-[[2-(methylamino)-7H-purin-6-yl]amino]piperidin-2-one.
| Compound Name | 5-[[2-(methylamino)-7H-purin-6-yl]amino]piperidin-2-one |
|---|---|
| PubChem CID | 114785220 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 5-[[2-(methylamino)-7H-purin-6-yl]amino]piperidin-2-one |
| SMILES | CNc1nc(NC2CCC(=O)NC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H15N7O/c1-12-11-17-9-8(14-5-15-9)10(18-11)16-6-2-3-7(19)13-4-6/h5-6H,2-4H2,1H3,(H,13,19)(H3,12,14,15,16,17,18) |
| InChIKey | PQEZBEAVHAMFFE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |