C8H11N5OS — CID 114788274
2-[[2-(methylamino)-7H-purin-6-yl]sulfanyl]ethanol (PubChem CID 114788274) has the molecular formula C8H11N5OS and a molecular weight of 225.28 g/mol. Its IUPAC name is 2-[[2-(methylamino)-7H-purin-6-yl]sulfanyl]ethanol.
| Compound Name | 2-[[2-(methylamino)-7H-purin-6-yl]sulfanyl]ethanol |
|---|---|
| PubChem CID | 114788274 |
| Molecular Formula | C8H11N5OS |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-[[2-(methylamino)-7H-purin-6-yl]sulfanyl]ethanol |
| SMILES | CNc1nc(SCCO)c2[nH]cnc2n1 |
| InChI | InChI=1S/C8H11N5OS/c1-9-8-12-6-5(10-4-11-6)7(13-8)15-3-2-14/h4,14H,2-3H2,1H3,(H2,9,10,11,12,13) |
| InChIKey | FFPIZYTYHPBKHJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |