C16H14ClFeN5-6 — CID 11985898
6-chloro-N-(cyclopenta-2,4-dien-1-ylmethyl)-7H-purin-2-amine;cyclopentane;iron (PubChem CID 11985898) has the molecular formula C16H14ClFeN5-6 and a molecular weight of 367.62 g/mol. Its IUPAC name is 6-chloro-N-(cyclopenta-2,4-dien-1-ylmethyl)-7H-purin-2-amine;cyclopentane;iron.
| Compound Name | 6-chloro-N-(cyclopenta-2,4-dien-1-ylmethyl)-7H-purin-2-amine;cyclopentane;iron |
|---|---|
| PubChem CID | 11985898 |
| Molecular Formula | C16H14ClFeN5-6 |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 6-chloro-N-(cyclopenta-2,4-dien-1-ylmethyl)-7H-purin-2-amine;cyclopentane;iron |
| SMILES | Clc1nc(NC[c-]2cccc2)nc2nc[nH]c12.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C11H9ClN5.C5H5.Fe/c12-9-8-10(15-6-14-8)17-11(16-9)13-5-7-3-1-2-4-7;1-2-4-5-3-1;/h1-4,6H,5H2,(H2,13,14,15,16,17);1-5H;/q-1;-5; |
| InChIKey | FIFWEIUVCMICGG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|