C13H12ClN5S — CID 114788260
6-(2-chlorophenyl)sulfanyl-N-ethyl-7H-purin-2-amine (PubChem CID 114788260) has the molecular formula C13H12ClN5S and a molecular weight of 305.79 g/mol. Its IUPAC name is 6-(2-chlorophenyl)sulfanyl-N-ethyl-7H-purin-2-amine.
| Compound Name | 6-(2-chlorophenyl)sulfanyl-N-ethyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114788260 |
| Molecular Formula | C13H12ClN5S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 6-(2-chlorophenyl)sulfanyl-N-ethyl-7H-purin-2-amine |
| SMILES | CCNc1nc(Sc2ccccc2Cl)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H12ClN5S/c1-2-15-13-18-11-10(16-7-17-11)12(19-13)20-9-6-4-3-5-8(9)14/h3-7H,2H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | ODDADFQBINXDDX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |