C10H13ClN6 — CID 19917431
N'-(6-chloro-7H-purin-2-yl)-N,N-diethylmethanimidamide (PubChem CID 19917431) has the molecular formula C10H13ClN6 and a molecular weight of 252.71 g/mol. Its IUPAC name is N'-(6-chloro-7H-purin-2-yl)-N,N-diethylmethanimidamide.
| Compound Name | N'-(6-chloro-7H-purin-2-yl)-N,N-diethylmethanimidamide |
|---|---|
| PubChem CID | 19917431 |
| Molecular Formula | C10H13ClN6 |
| Molecular Weight | 252.71 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | N'-(6-chloro-7H-purin-2-yl)-N,N-diethylmethanimidamide |
| SMILES | CCN(/C=N/c1nc(Cl)c2[nH]cnc2n1)CC |
| InChI | InChI=1S/C10H13ClN6/c1-3-17(4-2)6-14-10-15-8(11)7-9(16-10)13-5-12-7/h5-6H,3-4H2,1-2H3,(H,12,13,15,16)/b14-6+ |
| InChIKey | GVXBCNKEPFKJTH-MKMNVTDBSA-N |
| XLogP | 2.01 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.71 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|