C8H4ClN7OS — CID 114052468
N-(6-chloro-7H-purin-2-yl)thiadiazole-5-carboxamide (PubChem CID 114052468) has the molecular formula C8H4ClN7OS and a molecular weight of 281.69 g/mol. Its IUPAC name is N-(6-chloro-7H-purin-2-yl)thiadiazole-5-carboxamide.
| Compound Name | N-(6-chloro-7H-purin-2-yl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 114052468 |
| Molecular Formula | C8H4ClN7OS |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | N-(6-chloro-7H-purin-2-yl)thiadiazole-5-carboxamide |
| SMILES | O=C(Nc1nc(Cl)c2[nH]cnc2n1)c1cnns1 |
| InChI | InChI=1S/C8H4ClN7OS/c9-5-4-6(11-2-10-4)14-8(13-5)15-7(17)3-1-12-16-18-3/h1-2H,(H2,10,11,13,14,15,17) |
| InChIKey | ADNBQOVANCIVLN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |