C13H21N7O — CID 114786088
2-[[2-(ethylamino)-7H-purin-6-yl]amino]-N-(2-methylpropyl)acetamide (PubChem CID 114786088) has the molecular formula C13H21N7O and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-[[2-(ethylamino)-7H-purin-6-yl]amino]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[[2-(ethylamino)-7H-purin-6-yl]amino]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 114786088 |
| Molecular Formula | C13H21N7O |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-[[2-(ethylamino)-7H-purin-6-yl]amino]-N-(2-methylpropyl)acetamide |
| SMILES | CCNc1nc(NCC(=O)NCC(C)C)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H21N7O/c1-4-14-13-19-11(10-12(20-13)18-7-17-10)16-6-9(21)15-5-8(2)3/h7-8H,4-6H2,1-3H3,(H,15,21)(H3,14,16,17,18,19,20) |
| InChIKey | YIMJNBSCOIKPKR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |