C12H17N7O3 — CID 67635538
3-[2-aminoethyl-[2-(6-amino-7H-purin-2-yl)acetyl]amino]propanoic acid (PubChem CID 67635538) has the molecular formula C12H17N7O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 3-[2-aminoethyl-[2-(6-amino-7H-purin-2-yl)acetyl]amino]propanoic acid.
| Compound Name | 3-[2-aminoethyl-[2-(6-amino-7H-purin-2-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67635538 |
| Molecular Formula | C12H17N7O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-[2-aminoethyl-[2-(6-amino-7H-purin-2-yl)acetyl]amino]propanoic acid |
| SMILES | NCCN(CCC(=O)O)C(=O)Cc1nc(N)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H17N7O3/c13-2-4-19(3-1-9(21)22)8(20)5-7-17-11(14)10-12(18-7)16-6-15-10/h6H,1-5,13H2,(H,21,22)(H3,14,15,16,17,18) |
| InChIKey | XIQDZPJJOXZLGS-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 164.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |