C9H13ClN6O — CID 67008573
4-amino-N-(7H-purin-6-yl)butanamide;hydrochloride (PubChem CID 67008573) has the molecular formula C9H13ClN6O and a molecular weight of 256.70 g/mol. Its IUPAC name is 4-amino-N-(7H-purin-6-yl)butanamide;hydrochloride.
| Compound Name | 4-amino-N-(7H-purin-6-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 67008573 |
| Molecular Formula | C9H13ClN6O |
| Molecular Weight | 256.70 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-amino-N-(7H-purin-6-yl)butanamide;hydrochloride |
| SMILES | Cl.NCCCC(=O)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C9H12N6O.ClH/c10-3-1-2-6(16)15-9-7-8(12-4-11-7)13-5-14-9;/h4-5H,1-3,10H2,(H2,11,12,13,14,15,16);1H |
| InChIKey | GQJICNMTQFZFJY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.70 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |