C14H20N6O3 — CID 44600958
tert-butyl N-methyl-N-[3-oxo-3-(7H-purin-6-ylamino)propyl]carbamate (PubChem CID 44600958) has the molecular formula C14H20N6O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[3-oxo-3-(7H-purin-6-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[3-oxo-3-(7H-purin-6-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 44600958 |
| Molecular Formula | C14H20N6O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | tert-butyl N-methyl-N-[3-oxo-3-(7H-purin-6-ylamino)propyl]carbamate |
| SMILES | CN(CCC(=O)Nc1ncnc2nc[nH]c12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H20N6O3/c1-14(2,3)23-13(22)20(4)6-5-9(21)19-12-10-11(16-7-15-10)17-8-18-12/h7-8H,5-6H2,1-4H3,(H2,15,16,17,18,19,21) |
| InChIKey | SITZINCUSISUOY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |