C16H20Cl2N6O — CID 67008624
3-(2-phenylethylamino)-N-(7H-purin-6-yl)propanamide;dihydrochloride (PubChem CID 67008624) has the molecular formula C16H20Cl2N6O and a molecular weight of 383.28 g/mol. Its IUPAC name is 3-(2-phenylethylamino)-N-(7H-purin-6-yl)propanamide;dihydrochloride.
| Compound Name | 3-(2-phenylethylamino)-N-(7H-purin-6-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 67008624 |
| Molecular Formula | C16H20Cl2N6O |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 3-(2-phenylethylamino)-N-(7H-purin-6-yl)propanamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCNCCc1ccccc1)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C16H18N6O.2ClH/c23-13(7-9-17-8-6-12-4-2-1-3-5-12)22-16-14-15(19-10-18-14)20-11-21-16;;/h1-5,10-11,17H,6-9H2,(H2,18,19,20,21,22,23);2*1H |
| InChIKey | HBDFOPIJSDHARN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|