C15H13F3N6O2 — CID 42569285
3-(7H-purin-6-ylamino)-N-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 42569285) has the molecular formula C15H13F3N6O2 and a molecular weight of 366.30 g/mol. Its IUPAC name is 3-(7H-purin-6-ylamino)-N-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 3-(7H-purin-6-ylamino)-N-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 42569285 |
| Molecular Formula | C15H13F3N6O2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 3-(7H-purin-6-ylamino)-N-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | O=C(CCNc1ncnc2nc[nH]c12)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F3N6O2/c16-15(17,18)26-10-3-1-9(2-4-10)24-11(25)5-6-19-13-12-14(21-7-20-12)23-8-22-13/h1-4,7-8H,5-6H2,(H,24,25)(H2,19,20,21,22,23) |
| InChIKey | FJPCIZHZAJCRMV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |