C16H13F4NO2S — CID 7957157
3-(4-fluorophenyl)sulfanyl-N-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 7957157) has the molecular formula C16H13F4NO2S and a molecular weight of 359.34 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-N-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-N-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 7957157 |
| Molecular Formula | C16H13F4NO2S |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-N-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | O=C(CCSc1ccc(F)cc1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F4NO2S/c17-11-1-7-14(8-2-11)24-10-9-15(22)21-12-3-5-13(6-4-12)23-16(18,19)20/h1-8H,9-10H2,(H,21,22) |
| InChIKey | WJHHCYXXIPBQGZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |