C11H16N6O2 — CID 175389383
1-hydroxy-1-pentyl-3-(7H-purin-6-yl)urea (PubChem CID 175389383) has the molecular formula C11H16N6O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-hydroxy-1-pentyl-3-(7H-purin-6-yl)urea.
| Compound Name | 1-hydroxy-1-pentyl-3-(7H-purin-6-yl)urea |
|---|---|
| PubChem CID | 175389383 |
| Molecular Formula | C11H16N6O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-hydroxy-1-pentyl-3-(7H-purin-6-yl)urea |
| SMILES | CCCCCN(O)C(=O)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H16N6O2/c1-2-3-4-5-17(19)11(18)16-10-8-9(13-6-12-8)14-7-15-10/h6-7,19H,2-5H2,1H3,(H2,12,13,14,15,16,18) |
| InChIKey | XJRQEOAYSXJXNQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|