C12H11N5O — CID 145321450
(2E)-2-ethenyl-N-(7H-purin-6-yl)penta-2,4-dienamide (PubChem CID 145321450) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is (2E)-2-ethenyl-N-(7H-purin-6-yl)penta-2,4-dienamide.
| Compound Name | (2E)-2-ethenyl-N-(7H-purin-6-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 145321450 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (2E)-2-ethenyl-N-(7H-purin-6-yl)penta-2,4-dienamide |
| SMILES | C=C/C=C(\C=C)C(=O)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H11N5O/c1-3-5-8(4-2)12(18)17-11-9-10(14-6-13-9)15-7-16-11/h3-7H,1-2H2,(H2,13,14,15,16,17,18)/b8-5+ |
| InChIKey | MPLZJTXPLCSUPH-VMPITWQZSA-N |
| XLogP | 1.59 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|