C16H16N6O3 — CID 135819639
5-methyl-8-(3,4,5-trimethoxyphenyl)-1H-[1,2,4]triazolo[5,1-f]purine (PubChem CID 135819639) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is 5-methyl-8-(3,4,5-trimethoxyphenyl)-1H-[1,2,4]triazolo[5,1-f]purine.
| Compound Name | 5-methyl-8-(3,4,5-trimethoxyphenyl)-1H-[1,2,4]triazolo[5,1-f]purine |
|---|---|
| PubChem CID | 135819639 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-methyl-8-(3,4,5-trimethoxyphenyl)-1H-[1,2,4]triazolo[5,1-f]purine |
| SMILES | COc1cc(-c2nc3c4[nH]cnc4nc(C)n3n2)cc(OC)c1OC |
| InChI | InChI=1S/C16H16N6O3/c1-8-19-15-12(17-7-18-15)16-20-14(21-22(8)16)9-5-10(23-2)13(25-4)11(6-9)24-3/h5-7H,1-4H3,(H,17,18) |
| InChIKey | ZXUPNUATBVHUKE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |