C16H15FN6 — CID 135443744
5-butyl-8-(4-fluorophenyl)-1H-[1,2,4]triazolo[5,1-f]purine (PubChem CID 135443744) has the molecular formula C16H15FN6 and a molecular weight of 310.34 g/mol. Its IUPAC name is 5-butyl-8-(4-fluorophenyl)-1H-[1,2,4]triazolo[5,1-f]purine.
| Compound Name | 5-butyl-8-(4-fluorophenyl)-1H-[1,2,4]triazolo[5,1-f]purine |
|---|---|
| PubChem CID | 135443744 |
| Molecular Formula | C16H15FN6 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-butyl-8-(4-fluorophenyl)-1H-[1,2,4]triazolo[5,1-f]purine |
| SMILES | CCCCc1nc2nc[nH]c2c2nc(-c3ccc(F)cc3)nn12 |
| InChI | InChI=1S/C16H15FN6/c1-2-3-4-12-20-15-13(18-9-19-15)16-21-14(22-23(12)16)10-5-7-11(17)8-6-10/h5-9H,2-4H2,1H3,(H,18,19) |
| InChIKey | GFMITWSKUGIEPN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |