C17H19N7O — CID 163425620
2-methyl-4-pentyl-8-pyridin-4-yl-1H-[1,2,4]triazolo[5,1-f]purin-5-one (PubChem CID 163425620) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is 2-methyl-4-pentyl-8-pyridin-4-yl-1H-[1,2,4]triazolo[5,1-f]purin-5-one.
| Compound Name | 2-methyl-4-pentyl-8-pyridin-4-yl-1H-[1,2,4]triazolo[5,1-f]purin-5-one |
|---|---|
| PubChem CID | 163425620 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-methyl-4-pentyl-8-pyridin-4-yl-1H-[1,2,4]triazolo[5,1-f]purin-5-one |
| SMILES | CCCCCn1c(=O)n2nc(-c3ccncc3)nc2c2[nH]c(C)nc21 |
| InChI | InChI=1S/C17H19N7O/c1-3-4-5-10-23-15-13(19-11(2)20-15)16-21-14(22-24(16)17(23)25)12-6-8-18-9-7-12/h6-9H,3-5,10H2,1-2H3,(H,19,20) |
| InChIKey | AMGBGRLANJLIOI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|