C17H22N4O — CID 70530368
6-heptyl-2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-one (PubChem CID 70530368) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 6-heptyl-2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-one.
| Compound Name | 6-heptyl-2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-one |
|---|---|
| PubChem CID | 70530368 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 6-heptyl-2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-one |
| SMILES | CCCCCCCn1c(=O)n2nc(C)nc2c2ccccc21 |
| InChI | InChI=1S/C17H22N4O/c1-3-4-5-6-9-12-20-15-11-8-7-10-14(15)16-18-13(2)19-21(16)17(20)22/h7-8,10-11H,3-6,9,12H2,1-2H3 |
| InChIKey | MSRZMTAVYDITJN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|