C13H11N7O — CID 136829864
3-methoxy-4-(9H-[1,2,4]triazolo[3,4-f]purin-3-yl)aniline (PubChem CID 136829864) has the molecular formula C13H11N7O and a molecular weight of 281.28 g/mol. Its IUPAC name is 3-methoxy-4-(9H-[1,2,4]triazolo[3,4-f]purin-3-yl)aniline.
| Compound Name | 3-methoxy-4-(9H-[1,2,4]triazolo[3,4-f]purin-3-yl)aniline |
|---|---|
| PubChem CID | 136829864 |
| Molecular Formula | C13H11N7O |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-methoxy-4-(9H-[1,2,4]triazolo[3,4-f]purin-3-yl)aniline |
| SMILES | COc1cc(N)ccc1-c1nnc2c3[nH]cnc3ncn12 |
| InChI | InChI=1S/C13H11N7O/c1-21-9-4-7(14)2-3-8(9)12-18-19-13-10-11(16-5-15-10)17-6-20(12)13/h2-6H,14H2,1H3,(H,15,16) |
| InChIKey | ZFVBUFSIZHBKGA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|