C20H19N5O2 — CID 57413857
4-methoxy-3-[3-(2-methoxy-4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]aniline (PubChem CID 57413857) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 4-methoxy-3-[3-(2-methoxy-4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]aniline.
| Compound Name | 4-methoxy-3-[3-(2-methoxy-4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]aniline |
|---|---|
| PubChem CID | 57413857 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 4-methoxy-3-[3-(2-methoxy-4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]aniline |
| SMILES | COc1ccc(N)cc1-c1ccc2nnc(-c3ccc(C)cc3OC)n2n1 |
| InChI | InChI=1S/C20H19N5O2/c1-12-4-6-14(18(10-12)27-3)20-23-22-19-9-7-16(24-25(19)20)15-11-13(21)5-8-17(15)26-2/h4-11H,21H2,1-3H3 |
| InChIKey | YKTJOCNQECELOU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|