C18H13F2N5S — CID 142345342
4-(2,4-difluorophenyl)sulfanyl-3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline (PubChem CID 142345342) has the molecular formula C18H13F2N5S and a molecular weight of 369.40 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)sulfanyl-3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline.
| Compound Name | 4-(2,4-difluorophenyl)sulfanyl-3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline |
|---|---|
| PubChem CID | 142345342 |
| Molecular Formula | C18H13F2N5S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-(2,4-difluorophenyl)sulfanyl-3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline |
| SMILES | Cc1nnc2ccc(-c3cc(N)ccc3Sc3ccc(F)cc3F)nn12 |
| InChI | InChI=1S/C18H13F2N5S/c1-10-22-23-18-7-4-15(24-25(10)18)13-9-12(21)3-6-16(13)26-17-5-2-11(19)8-14(17)20/h2-9H,21H2,1H3 |
| InChIKey | RNLTZLIYBXVIEO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|