C15H24N6O — CID 143940325
2-[4-(oxan-4-ylmethylamino)butyl]-7H-purin-6-amine (PubChem CID 143940325) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is 2-[4-(oxan-4-ylmethylamino)butyl]-7H-purin-6-amine.
| Compound Name | 2-[4-(oxan-4-ylmethylamino)butyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 143940325 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 2-[4-(oxan-4-ylmethylamino)butyl]-7H-purin-6-amine |
| SMILES | Nc1nc(CCCCNCC2CCOCC2)nc2nc[nH]c12 |
| InChI | InChI=1S/C15H24N6O/c16-14-13-15(19-10-18-13)21-12(20-14)3-1-2-6-17-9-11-4-7-22-8-5-11/h10-11,17H,1-9H2,(H3,16,18,19,20,21) |
| InChIKey | WUIJKPSKTUWLEG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|