C12H18N6 — CID 143581709
2-[2-[(3S)-piperidin-3-yl]ethyl]-7H-purin-6-amine (PubChem CID 143581709) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is 2-[2-[(3S)-piperidin-3-yl]ethyl]-7H-purin-6-amine.
| Compound Name | 2-[2-[(3S)-piperidin-3-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 143581709 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-[2-[(3S)-piperidin-3-yl]ethyl]-7H-purin-6-amine |
| SMILES | Nc1nc(CC[C@@H]2CCCNC2)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H18N6/c13-11-10-12(16-7-15-10)18-9(17-11)4-3-8-2-1-5-14-6-8/h7-8,14H,1-6H2,(H3,13,15,16,17,18)/t8-/m0/s1 |
| InChIKey | ZGTJCVZCIWKSHV-QMMMGPOBSA-N |
| XLogP | 0.87 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |