C12H20N8 — CID 104623212
6-N-[2-(4-methylpiperazin-1-yl)ethyl]-7H-purine-2,6-diamine (PubChem CID 104623212) has the molecular formula C12H20N8 and a molecular weight of 276.35 g/mol. Its IUPAC name is 6-N-[2-(4-methylpiperazin-1-yl)ethyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-[2-(4-methylpiperazin-1-yl)ethyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 104623212 |
| Molecular Formula | C12H20N8 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 6-N-[2-(4-methylpiperazin-1-yl)ethyl]-7H-purine-2,6-diamine |
| SMILES | CN1CCN(CCNc2nc(N)nc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C12H20N8/c1-19-4-6-20(7-5-19)3-2-14-10-9-11(16-8-15-9)18-12(13)17-10/h8H,2-7H2,1H3,(H4,13,14,15,16,17,18) |
| InChIKey | RAGHEDGBQCRZKI-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |