C13H21N7 — CID 114785101
6-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-7H-purine-2,6-diamine (PubChem CID 114785101) has the molecular formula C13H21N7 and a molecular weight of 275.36 g/mol. Its IUPAC name is 6-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785101 |
| Molecular Formula | C13H21N7 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 6-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-7H-purine-2,6-diamine |
| SMILES | CC(CNc1nc(N)nc2nc[nH]c12)CN1CCCC1 |
| InChI | InChI=1S/C13H21N7/c1-9(7-20-4-2-3-5-20)6-15-11-10-12(17-8-16-10)19-13(14)18-11/h8-9H,2-7H2,1H3,(H4,14,15,16,17,18,19) |
| InChIKey | JWELZZUZWFNQOP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |