C13H19ClN6 — CID 104697676
2-chloro-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-7H-purin-6-amine (PubChem CID 104697676) has the molecular formula C13H19ClN6 and a molecular weight of 294.79 g/mol. Its IUPAC name is 2-chloro-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 104697676 |
| Molecular Formula | C13H19ClN6 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-chloro-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-7H-purin-6-amine |
| SMILES | CC(CNc1nc(Cl)nc2nc[nH]c12)CN1CCCC1 |
| InChI | InChI=1S/C13H19ClN6/c1-9(7-20-4-2-3-5-20)6-15-11-10-12(17-8-16-10)19-13(14)18-11/h8-9H,2-7H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | LWTRAVGDNRWYSA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |