C9H10N5O2P — CID 153326115
2-[2-[(oxo-λ5-phosphanylidyne)methoxy]propyl]-7H-purin-6-amine (PubChem CID 153326115) has the molecular formula C9H10N5O2P and a molecular weight of 251.19 g/mol. Its IUPAC name is 2-[2-[(oxo-λ5-phosphanylidyne)methoxy]propyl]-7H-purin-6-amine.
| Compound Name | 2-[2-[(oxo-λ5-phosphanylidyne)methoxy]propyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 153326115 |
| Molecular Formula | C9H10N5O2P |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-[2-[(oxo-λ5-phosphanylidyne)methoxy]propyl]-7H-purin-6-amine |
| SMILES | CC(Cc1nc(N)c2[nH]cnc2n1)OC#P=O |
| InChI | InChI=1S/C9H10N5O2P/c1-5(16-4-17-15)2-6-13-8(10)7-9(14-6)12-3-11-7/h3,5H,2H2,1H3,(H3,10,11,12,13,14) |
| InChIKey | VCUOSEXUTALZEM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|