C12H18N6O2S — CID 102887635
N-ethyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-7H-purin-2-amine (PubChem CID 102887635) has the molecular formula C12H18N6O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-ethyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-7H-purin-2-amine.
| Compound Name | N-ethyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 102887635 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-ethyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-7H-purin-2-amine |
| SMILES | CCNc1nc(N2CCS(=O)(=O)CC2C)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H18N6O2S/c1-3-13-12-16-10-9(14-7-15-10)11(17-12)18-4-5-21(19,20)6-8(18)2/h7-8H,3-6H2,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | BDXJXWUZEZJONY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |