About N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine
N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine (PubChem CID 114786604) has the molecular formula C14H23N7
and a molecular weight of 289.39 g/mol. Its IUPAC name is N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine |
| PubChem CID | 114786604 |
| Molecular Formula | C14H23N7 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine |
| SMILES | CCNc1nc(N2CC(C)N(C)C(C)C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H23N7/c1-5-15-14-18-12-11(16-8-17-12)13(19-14)21-6-9(2)20(4)10(3)7-21/h8-10H,5-7H2,1-4H3,(H2,15,16,17,18,19) |
| InChIKey | YAWSTYYCAHVBFV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine?
The IUPAC name of N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine (CID 114786604) is N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine.
What is the SMILES notation for N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine?
The canonical SMILES for N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine is CCNc1nc(N2CC(C)N(C)C(C)C2)c2[nH]cnc2n1.
What is the InChIKey of N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine?
The InChIKey is YAWSTYYCAHVBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N7/c1-5-15-14-18-12-11(16-8-17-12)13(19-14)21-6-9(2)20(4)10(3)7-21/h8-10H,5-7H2,1-4H3,(H2,15,16,17,18,19).
What are the key properties of N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine?
N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine has a molecular weight of 289.39 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine is sourced from PubChem (CID 114786604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).