C14H23N7 — CID 114786604
N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine (PubChem CID 114786604) has the molecular formula C14H23N7 and a molecular weight of 289.39 g/mol. Its IUPAC name is N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine.
| Compound Name | N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 114786604 |
| Molecular Formula | C14H23N7 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-ethyl-6-(3,4,5-trimethylpiperazin-1-yl)-7H-purin-2-amine |
| SMILES | CCNc1nc(N2CC(C)N(C)C(C)C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H23N7/c1-5-15-14-18-12-11(16-8-17-12)13(19-14)21-6-9(2)20(4)10(3)7-21/h8-10H,5-7H2,1-4H3,(H2,15,16,17,18,19) |
| InChIKey | YAWSTYYCAHVBFV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |