C12H18N6O2 — CID 102939050
[6-methyl-4-[2-(methylamino)-7H-purin-6-yl]morpholin-2-yl]methanol (PubChem CID 102939050) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is [6-methyl-4-[2-(methylamino)-7H-purin-6-yl]morpholin-2-yl]methanol.
| Compound Name | [6-methyl-4-[2-(methylamino)-7H-purin-6-yl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 102939050 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [6-methyl-4-[2-(methylamino)-7H-purin-6-yl]morpholin-2-yl]methanol |
| SMILES | CNc1nc(N2CC(C)OC(CO)C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H18N6O2/c1-7-3-18(4-8(5-19)20-7)11-9-10(15-6-14-9)16-12(13-2)17-11/h6-8,19H,3-5H2,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | KSGLIKMZJWOFSP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |