C18H21N7O — CID 117092148
6-N-cyclopropyl-8-N-(4-morpholin-4-ylphenyl)-7H-purine-6,8-diamine (PubChem CID 117092148) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is 6-N-cyclopropyl-8-N-(4-morpholin-4-ylphenyl)-7H-purine-6,8-diamine.
| Compound Name | 6-N-cyclopropyl-8-N-(4-morpholin-4-ylphenyl)-7H-purine-6,8-diamine |
|---|---|
| PubChem CID | 117092148 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 6-N-cyclopropyl-8-N-(4-morpholin-4-ylphenyl)-7H-purine-6,8-diamine |
| SMILES | c1nc(NC2CC2)c2[nH]c(Nc3ccc(N4CCOCC4)cc3)nc2n1 |
| InChI | InChI=1S/C18H21N7O/c1-2-12(1)21-16-15-17(20-11-19-16)24-18(23-15)22-13-3-5-14(6-4-13)25-7-9-26-10-8-25/h3-6,11-12H,1-2,7-10H2,(H3,19,20,21,22,23,24) |
| InChIKey | HRMVLOIJRFYUCE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|